C31H38F4N2O6S — CID 168782634
(1R,2S,3R,4S)-3-[(4-fluoro-2-methoxy-5-octoxybenzoyl)amino]-N-[3-(trifluoromethylsulfonyl)phenyl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 168782634) has the molecular formula C31H38F4N2O6S and a molecular weight of 642.71 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-[(4-fluoro-2-methoxy-5-octoxybenzoyl)amino]-N-[3-(trifluoromethylsulfonyl)phenyl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2S,3R,4S)-3-[(4-fluoro-2-methoxy-5-octoxybenzoyl)amino]-N-[3-(trifluoromethylsulfonyl)phenyl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 168782634 |
| Molecular Formula | C31H38F4N2O6S |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | (1R,2S,3R,4S)-3-[(4-fluoro-2-methoxy-5-octoxybenzoyl)amino]-N-[3-(trifluoromethylsulfonyl)phenyl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CCCCCCCCOc1cc(C(=O)N[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C(=O)Nc2cccc(S(=O)(=O)C(F)(F)F)c2)c(OC)cc1F |
| InChI | InChI=1S/C31H38F4N2O6S/c1-3-4-5-6-7-8-14-43-26-17-23(25(42-2)18-24(26)32)29(38)37-28-20-13-12-19(15-20)27(28)30(39)36-21-10-9-11-22(16-21)44(40,41)31(33,34)35/h9-11,16-20,27-28H,3-8,12-15H2,1-2H3,(H,36,39)(H,37,38)/t19-,20+,27+,28-/m1/s1 |
| InChIKey | CTIHMTXRJARPHY-HFDGUFSPSA-N |
| XLogP | 6.65 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|