About N-[4-[(2-acetyl-1,3-benzothiazol-4-yl)amino]cyclohexyl]-4-fluorobenzamide
N-[4-[(2-acetyl-1,3-benzothiazol-4-yl)amino]cyclohexyl]-4-fluorobenzamide (PubChem CID 168782775) has the molecular formula C22H22FN3O2S
and a molecular weight of 411.50 g/mol. Its IUPAC name is N-[4-[(2-acetyl-1,3-benzothiazol-4-yl)amino]cyclohexyl]-4-fluorobenzamide.
Molecular Properties
| Compound Name | N-[4-[(2-acetyl-1,3-benzothiazol-4-yl)amino]cyclohexyl]-4-fluorobenzamide |
| PubChem CID | 168782775 |
| Molecular Formula | C22H22FN3O2S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-[4-[(2-acetyl-1,3-benzothiazol-4-yl)amino]cyclohexyl]-4-fluorobenzamide |
| SMILES | CC(=O)c1nc2c(NC3CCC(NC(=O)c4ccc(F)cc4)CC3)cccc2s1 |
| InChI | InChI=1S/C22H22FN3O2S/c1-13(27)22-26-20-18(3-2-4-19(20)29-22)24-16-9-11-17(12-10-16)25-21(28)14-5-7-15(23)8-6-14/h2-8,16-17,24H,9-12H2,1H3,(H,25,28) |
| InChIKey | GLOIXAVNKUUJIG-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-[(2-acetyl-1,3-benzothiazol-4-yl)amino]cyclohexyl]-4-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2-acetyl-1,3-benzothiazol-4-yl)amino]cyclohexyl]-4-fluorobenzamide?
The IUPAC name of N-[4-[(2-acetyl-1,3-benzothiazol-4-yl)amino]cyclohexyl]-4-fluorobenzamide (CID 168782775) is N-[4-[(2-acetyl-1,3-benzothiazol-4-yl)amino]cyclohexyl]-4-fluorobenzamide.
What is the SMILES notation for N-[4-[(2-acetyl-1,3-benzothiazol-4-yl)amino]cyclohexyl]-4-fluorobenzamide?
The canonical SMILES for N-[4-[(2-acetyl-1,3-benzothiazol-4-yl)amino]cyclohexyl]-4-fluorobenzamide is CC(=O)c1nc2c(NC3CCC(NC(=O)c4ccc(F)cc4)CC3)cccc2s1.
What is the InChIKey of N-[4-[(2-acetyl-1,3-benzothiazol-4-yl)amino]cyclohexyl]-4-fluorobenzamide?
The InChIKey is GLOIXAVNKUUJIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22FN3O2S/c1-13(27)22-26-20-18(3-2-4-19(20)29-22)24-16-9-11-17(12-10-16)25-21(28)14-5-7-15(23)8-6-14/h2-8,16-17,24H,9-12H2,1H3,(H,25,28).
What are the key properties of N-[4-[(2-acetyl-1,3-benzothiazol-4-yl)amino]cyclohexyl]-4-fluorobenzamide?
N-[4-[(2-acetyl-1,3-benzothiazol-4-yl)amino]cyclohexyl]-4-fluorobenzamide has a molecular weight of 411.50 g/mol, XLogP of 4.79, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2-acetyl-1,3-benzothiazol-4-yl)amino]cyclohexyl]-4-fluorobenzamide is sourced from PubChem (CID 168782775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).