C21H24F3N7O — CID 168782777
(E)-2-(5-amino-1H-pyrazol-4-yl)-N-[4-[[2-(trifluoromethyl)imidazo[1,2-a]pyridin-5-yl]amino]cyclohexyl]but-2-enamide (PubChem CID 168782777) has the molecular formula C21H24F3N7O and a molecular weight of 447.47 g/mol. Its IUPAC name is (E)-2-(5-amino-1H-pyrazol-4-yl)-N-[4-[[2-(trifluoromethyl)imidazo[1,2-a]pyridin-5-yl]amino]cyclohexyl]but-2-enamide.
| Compound Name | (E)-2-(5-amino-1H-pyrazol-4-yl)-N-[4-[[2-(trifluoromethyl)imidazo[1,2-a]pyridin-5-yl]amino]cyclohexyl]but-2-enamide |
|---|---|
| PubChem CID | 168782777 |
| Molecular Formula | C21H24F3N7O |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (E)-2-(5-amino-1H-pyrazol-4-yl)-N-[4-[[2-(trifluoromethyl)imidazo[1,2-a]pyridin-5-yl]amino]cyclohexyl]but-2-enamide |
| SMILES | C/C=C(/C(=O)NC1CCC(Nc2cccc3nc(C(F)(F)F)cn23)CC1)c1cn[nH]c1N |
| InChI | InChI=1S/C21H24F3N7O/c1-2-14(15-10-26-30-19(15)25)20(32)28-13-8-6-12(7-9-13)27-17-4-3-5-18-29-16(11-31(17)18)21(22,23)24/h2-5,10-13,27H,6-9H2,1H3,(H,28,32)(H3,25,26,30)/b14-2+ |
| InChIKey | XPMAOTLXDLXQAM-JLZUIIAYSA-N |
| XLogP | 3.60 |
| TPSA | 113.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|