About N-(3-methoxypropyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide
N-(3-methoxypropyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide (PubChem CID 16878281) has the molecular formula C15H18N2O3
and a molecular weight of 274.32 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-methoxypropyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide |
| PubChem CID | 16878281 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-(3-methoxypropyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide |
| SMILES | COCCCNC(=O)Cc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C15H18N2O3/c1-19-9-5-8-16-15(18)11-13-10-14(20-17-13)12-6-3-2-4-7-12/h2-4,6-7,10H,5,8-9,11H2,1H3,(H,16,18) |
| InChIKey | GDTATKQBWRRYHH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methoxypropyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxypropyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide?
The IUPAC name of N-(3-methoxypropyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide (CID 16878281) is N-(3-methoxypropyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide.
What is the SMILES notation for N-(3-methoxypropyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide?
The canonical SMILES for N-(3-methoxypropyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide is COCCCNC(=O)Cc1cc(-c2ccccc2)on1.
What is the InChIKey of N-(3-methoxypropyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide?
The InChIKey is GDTATKQBWRRYHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3/c1-19-9-5-8-16-15(18)11-13-10-14(20-17-13)12-6-3-2-4-7-12/h2-4,6-7,10H,5,8-9,11H2,1H3,(H,16,18).
What are the key properties of N-(3-methoxypropyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide?
N-(3-methoxypropyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide has a molecular weight of 274.32 g/mol, XLogP of 2.04, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxypropyl)-2-(5-phenyl-1,2-oxazol-3-yl)acetamide is sourced from PubChem (CID 16878281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).