About N-phenyl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide
N-phenyl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide (PubChem CID 16878309) has the molecular formula C17H14N2O2
and a molecular weight of 278.31 g/mol. Its IUPAC name is N-phenyl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide.
Molecular Properties
| Compound Name | N-phenyl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide |
| PubChem CID | 16878309 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | N-phenyl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide |
| SMILES | O=C(Cc1cc(-c2ccccc2)on1)Nc1ccccc1 |
| InChI | InChI=1S/C17H14N2O2/c20-17(18-14-9-5-2-6-10-14)12-15-11-16(21-19-15)13-7-3-1-4-8-13/h1-11H,12H2,(H,18,20) |
| InChIKey | VVXCTRPNDIFHGE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-phenyl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide?
The IUPAC name of N-phenyl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide (CID 16878309) is N-phenyl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide.
What is the SMILES notation for N-phenyl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide?
The canonical SMILES for N-phenyl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide is O=C(Cc1cc(-c2ccccc2)on1)Nc1ccccc1.
What is the InChIKey of N-phenyl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide?
The InChIKey is VVXCTRPNDIFHGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O2/c20-17(18-14-9-5-2-6-10-14)12-15-11-16(21-19-15)13-7-3-1-4-8-13/h1-11H,12H2,(H,18,20).
What are the key properties of N-phenyl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide?
N-phenyl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide has a molecular weight of 278.31 g/mol, XLogP of 3.52, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-2-(5-phenyl-1,2-oxazol-3-yl)acetamide is sourced from PubChem (CID 16878309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).