About 4-[(Z)-6-(1,4-dimethylthian-1-ium-4-yl)hex-2-enyl]-1,4-dimethylthian-1-ium
4-[(Z)-6-(1,4-dimethylthian-1-ium-4-yl)hex-2-enyl]-1,4-dimethylthian-1-ium (PubChem CID 168783148) has the molecular formula C20H38S2+2
and a molecular weight of 342.66 g/mol. Its IUPAC name is 4-[(Z)-6-(1,4-dimethylthian-1-ium-4-yl)hex-2-enyl]-1,4-dimethylthian-1-ium.
Molecular Properties
| Compound Name | 4-[(Z)-6-(1,4-dimethylthian-1-ium-4-yl)hex-2-enyl]-1,4-dimethylthian-1-ium |
| PubChem CID | 168783148 |
| Molecular Formula | C20H38S2+2 |
| Molecular Weight | 342.66 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 4-[(Z)-6-(1,4-dimethylthian-1-ium-4-yl)hex-2-enyl]-1,4-dimethylthian-1-ium |
| SMILES | C[S+]1CCC(C)(C/C=C\CCCC2(C)CC[S+](C)CC2)CC1 |
| InChI | InChI=1S/C20H38S2/c1-19(11-15-21(3)16-12-19)9-7-5-6-8-10-20(2)13-17-22(4)18-14-20/h5,7H,6,8-18H2,1-4H3/q+2/b7-5- |
| InChIKey | VEGGBRLQFXWVFG-ALCCZGGFSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-6-(1,4-dimethylthian-1-ium-4-yl)hex-2-enyl]-1,4-dimethylthian-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-6-(1,4-dimethylthian-1-ium-4-yl)hex-2-enyl]-1,4-dimethylthian-1-ium?
The IUPAC name of 4-[(Z)-6-(1,4-dimethylthian-1-ium-4-yl)hex-2-enyl]-1,4-dimethylthian-1-ium (CID 168783148) is 4-[(Z)-6-(1,4-dimethylthian-1-ium-4-yl)hex-2-enyl]-1,4-dimethylthian-1-ium.
What is the SMILES notation for 4-[(Z)-6-(1,4-dimethylthian-1-ium-4-yl)hex-2-enyl]-1,4-dimethylthian-1-ium?
The canonical SMILES for 4-[(Z)-6-(1,4-dimethylthian-1-ium-4-yl)hex-2-enyl]-1,4-dimethylthian-1-ium is C[S+]1CCC(C)(C/C=C\CCCC2(C)CC[S+](C)CC2)CC1.
What is the InChIKey of 4-[(Z)-6-(1,4-dimethylthian-1-ium-4-yl)hex-2-enyl]-1,4-dimethylthian-1-ium?
The InChIKey is VEGGBRLQFXWVFG-ALCCZGGFSA-N. The full InChI is InChI=1S/C20H38S2/c1-19(11-15-21(3)16-12-19)9-7-5-6-8-10-20(2)13-17-22(4)18-14-20/h5,7H,6,8-18H2,1-4H3/q+2/b7-5-.
What are the key properties of 4-[(Z)-6-(1,4-dimethylthian-1-ium-4-yl)hex-2-enyl]-1,4-dimethylthian-1-ium?
4-[(Z)-6-(1,4-dimethylthian-1-ium-4-yl)hex-2-enyl]-1,4-dimethylthian-1-ium has a molecular weight of 342.66 g/mol, XLogP of 5.20, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-6-(1,4-dimethylthian-1-ium-4-yl)hex-2-enyl]-1,4-dimethylthian-1-ium is sourced from PubChem (CID 168783148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).