About methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate
methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate (PubChem CID 16878333) has the molecular formula C19H16N2O4
and a molecular weight of 336.35 g/mol. Its IUPAC name is methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate.
Molecular Properties
| Compound Name | methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate |
| PubChem CID | 16878333 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)Cc2cc(-c3ccccc3)on2)cc1 |
| InChI | InChI=1S/C19H16N2O4/c1-24-19(23)14-7-9-15(10-8-14)20-18(22)12-16-11-17(25-21-16)13-5-3-2-4-6-13/h2-11H,12H2,1H3,(H,20,22) |
| InChIKey | WIHJSOTZBCCDCL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate?
The IUPAC name of methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate (CID 16878333) is methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate.
What is the SMILES notation for methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate?
The canonical SMILES for methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate is COC(=O)c1ccc(NC(=O)Cc2cc(-c3ccccc3)on2)cc1.
What is the InChIKey of methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate?
The InChIKey is WIHJSOTZBCCDCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O4/c1-24-19(23)14-7-9-15(10-8-14)20-18(22)12-16-11-17(25-21-16)13-5-3-2-4-6-13/h2-11H,12H2,1H3,(H,20,22).
What are the key properties of methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate?
methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate has a molecular weight of 336.35 g/mol, XLogP of 3.31, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate is sourced from PubChem (CID 16878333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).