methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate

C19H16N2O4 — CID 16878333

IUPACmethyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate
SMILESCOC(=O)c1ccc(NC(=O)Cc2cc(-c3ccccc3)on2)cc1
InChIInChI=1S/C19H16N2O4/c1-24-19(23)14-7-9-15(10-8-14)20-18(22)12-16-11-17(25-21-16)13-5-3-2-4-6-13/h2-11H,12H2,1H3,(H,20,22)
InChIKeyWIHJSOTZBCCDCL-UHFFFAOYSA-N
MW336.35 g/mol
LogP3.31
Rot. Bonds5

About methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate

methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate (PubChem CID 16878333) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate.

Molecular Properties

Compound Namemethyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate
PubChem CID16878333
Molecular FormulaC19H16N2O4
Molecular Weight336.35 g/mol
Exact Mass336.11
IUPAC Namemethyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate
SMILESCOC(=O)c1ccc(NC(=O)Cc2cc(-c3ccccc3)on2)cc1
InChIInChI=1S/C19H16N2O4/c1-24-19(23)14-7-9-15(10-8-14)20-18(22)12-16-11-17(25-21-16)13-5-3-2-4-6-13/h2-11H,12H2,1H3,(H,20,22)
InChIKeyWIHJSOTZBCCDCL-UHFFFAOYSA-N
XLogP3.31
TPSA81.43 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500336.35
LogP ≤ 53.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate?
The IUPAC name of methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate (CID 16878333) is methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate.
What is the SMILES notation for methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate?
The canonical SMILES for methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate is COC(=O)c1ccc(NC(=O)Cc2cc(-c3ccccc3)on2)cc1.
What is the InChIKey of methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate?
The InChIKey is WIHJSOTZBCCDCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O4/c1-24-19(23)14-7-9-15(10-8-14)20-18(22)12-16-11-17(25-21-16)13-5-3-2-4-6-13/h2-11H,12H2,1H3,(H,20,22).
What are the key properties of methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate?
methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate has a molecular weight of 336.35 g/mol, XLogP of 3.31, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[2-(5-phenyl-1,2-oxazol-3-yl)acetyl]amino]benzoate is sourced from PubChem (CID 16878333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).