C36H20N4O — CID 168785351
4-(4-fluoranthen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-[1]benzofuro[2,3-b]pyridine (PubChem CID 168785351) has the molecular formula C36H20N4O and a molecular weight of 524.58 g/mol. Its IUPAC name is 4-(4-fluoranthen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 4-(4-fluoranthen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 168785351 |
| Molecular Formula | C36H20N4O |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 4-(4-fluoranthen-2-yl-6-phenyl-1,3,5-triazin-2-yl)-[1]benzofuro[2,3-b]pyridine |
| SMILES | c1ccc(-c2nc(-c3cc4c5c(cccc5c3)-c3ccccc3-4)nc(-c3ccnc4oc5ccccc5c34)n2)cc1 |
| InChI | InChI=1S/C36H20N4O/c1-2-9-21(10-3-1)33-38-34(23-19-22-11-8-15-26-24-12-4-5-13-25(24)29(20-23)31(22)26)40-35(39-33)28-17-18-37-36-32(28)27-14-6-7-16-30(27)41-36/h1-20H |
| InChIKey | HFOIMXZPWDNDLW-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |