C32H20N4O — CID 168785581
9-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-phenyl-[1]benzofuro[3,2-c]pyridine (PubChem CID 168785581) has the molecular formula C32H20N4O and a molecular weight of 476.54 g/mol. Its IUPAC name is 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-phenyl-[1]benzofuro[3,2-c]pyridine.
| Compound Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-phenyl-[1]benzofuro[3,2-c]pyridine |
|---|---|
| PubChem CID | 168785581 |
| Molecular Formula | C32H20N4O |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-7-phenyl-[1]benzofuro[3,2-c]pyridine |
| SMILES | c1ccc(-c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c3c(c2)oc2ccncc23)cc1 |
| InChI | InChI=1S/C32H20N4O/c1-4-10-21(11-5-1)24-18-25(29-26-20-33-17-16-27(26)37-28(29)19-24)32-35-30(22-12-6-2-7-13-22)34-31(36-32)23-14-8-3-9-15-23/h1-20H |
| InChIKey | MTWOQPVJWWRECJ-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |