About (4-bromo-2-tert-butyl-3,5-difluorophenyl)methyl carbamate
(4-bromo-2-tert-butyl-3,5-difluorophenyl)methyl carbamate (PubChem CID 168786065) has the molecular formula C12H14BrF2NO2
and a molecular weight of 322.15 g/mol. Its IUPAC name is (4-bromo-2-tert-butyl-3,5-difluorophenyl)methyl carbamate.
Molecular Properties
| Compound Name | (4-bromo-2-tert-butyl-3,5-difluorophenyl)methyl carbamate |
| PubChem CID | 168786065 |
| Molecular Formula | C12H14BrF2NO2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | (4-bromo-2-tert-butyl-3,5-difluorophenyl)methyl carbamate |
| SMILES | CC(C)(C)c1c(COC(N)=O)cc(F)c(Br)c1F |
| InChI | InChI=1S/C12H14BrF2NO2/c1-12(2,3)8-6(5-18-11(16)17)4-7(14)9(13)10(8)15/h4H,5H2,1-3H3,(H2,16,17) |
| InChIKey | BZRHYEXPOUQBBE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-2-tert-butyl-3,5-difluorophenyl)methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2-tert-butyl-3,5-difluorophenyl)methyl carbamate?
The IUPAC name of (4-bromo-2-tert-butyl-3,5-difluorophenyl)methyl carbamate (CID 168786065) is (4-bromo-2-tert-butyl-3,5-difluorophenyl)methyl carbamate.
What is the SMILES notation for (4-bromo-2-tert-butyl-3,5-difluorophenyl)methyl carbamate?
The canonical SMILES for (4-bromo-2-tert-butyl-3,5-difluorophenyl)methyl carbamate is CC(C)(C)c1c(COC(N)=O)cc(F)c(Br)c1F.
What is the InChIKey of (4-bromo-2-tert-butyl-3,5-difluorophenyl)methyl carbamate?
The InChIKey is BZRHYEXPOUQBBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrF2NO2/c1-12(2,3)8-6(5-18-11(16)17)4-7(14)9(13)10(8)15/h4H,5H2,1-3H3,(H2,16,17).
What are the key properties of (4-bromo-2-tert-butyl-3,5-difluorophenyl)methyl carbamate?
(4-bromo-2-tert-butyl-3,5-difluorophenyl)methyl carbamate has a molecular weight of 322.15 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2-tert-butyl-3,5-difluorophenyl)methyl carbamate is sourced from PubChem (CID 168786065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).