C15H27NO — CID 168786112
3-[(4Z)-2,7-dimethylocta-2,4,6-trien-3-yl]oxy-N,N-dimethylpropan-1-amine (PubChem CID 168786112) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 3-[(4Z)-2,7-dimethylocta-2,4,6-trien-3-yl]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(4Z)-2,7-dimethylocta-2,4,6-trien-3-yl]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 168786112 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 3-[(4Z)-2,7-dimethylocta-2,4,6-trien-3-yl]oxy-N,N-dimethylpropan-1-amine |
| SMILES | CC(C)=C/C=C\C(OCCCN(C)C)=C(C)C |
| InChI | InChI=1S/C15H27NO/c1-13(2)9-7-10-15(14(3)4)17-12-8-11-16(5)6/h7,9-10H,8,11-12H2,1-6H3/b10-7- |
| InChIKey | VSVMIOXDIYQWPZ-YFHOEESVSA-N |
| XLogP | 3.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|