C31H38N2Si+2 — CID 168787602
methyl-[[1-methyl-6-[2-(2-methylphenyl)propan-2-yl]pyridin-1-ium-2-yl]methyl]-(2-methylphenyl)-(1-methylpyridin-1-ium-2-yl)silane (PubChem CID 168787602) has the molecular formula C31H38N2Si+2 and a molecular weight of 466.75 g/mol. Its IUPAC name is methyl-[[1-methyl-6-[2-(2-methylphenyl)propan-2-yl]pyridin-1-ium-2-yl]methyl]-(2-methylphenyl)-(1-methylpyridin-1-ium-2-yl)silane.
| Compound Name | methyl-[[1-methyl-6-[2-(2-methylphenyl)propan-2-yl]pyridin-1-ium-2-yl]methyl]-(2-methylphenyl)-(1-methylpyridin-1-ium-2-yl)silane |
|---|---|
| PubChem CID | 168787602 |
| Molecular Formula | C31H38N2Si+2 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | methyl-[[1-methyl-6-[2-(2-methylphenyl)propan-2-yl]pyridin-1-ium-2-yl]methyl]-(2-methylphenyl)-(1-methylpyridin-1-ium-2-yl)silane |
| SMILES | Cc1ccccc1C(C)(C)c1cccc(C[Si](C)(c2ccccc2C)c2cccc[n+]2C)[n+]1C |
| InChI | InChI=1S/C31H38N2Si/c1-24-15-8-10-18-27(24)31(3,4)29-20-14-17-26(33(29)6)23-34(7,28-19-11-9-16-25(28)2)30-21-12-13-22-32(30)5/h8-22H,23H2,1-7H3/q+2 |
| InChIKey | ALBGOXVDSRHJES-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|