C14H25NO2 — CID 168787967
1-[(2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 168787967) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-[(2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 168787967 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 1-[(2S,3aS,7aS)-2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1[C@H](CO)C[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C14H25NO2/c1-14(2,3)13(17)15-11(9-16)8-10-6-4-5-7-12(10)15/h10-12,16H,4-9H2,1-3H3/t10-,11-,12-/m0/s1 |
| InChIKey | IDUCNPFCXKMRKQ-SRVKXCTJSA-N |
| XLogP | 2.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |