About N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2,2-dimethylpropanamide
N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2,2-dimethylpropanamide (PubChem CID 168788092) has the molecular formula C13H23NO2
and a molecular weight of 225.33 g/mol. Its IUPAC name is N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2,2-dimethylpropanamide |
| PubChem CID | 168788092 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC1C2CCOC2C1(C)C |
| InChI | InChI=1S/C13H23NO2/c1-12(2,3)11(15)14-9-8-6-7-16-10(8)13(9,4)5/h8-10H,6-7H2,1-5H3,(H,14,15) |
| InChIKey | ACZJIEICZMXYSG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2,2-dimethylpropanamide?
The IUPAC name of N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2,2-dimethylpropanamide (CID 168788092) is N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2,2-dimethylpropanamide is CC(C)(C)C(=O)NC1C2CCOC2C1(C)C.
What is the InChIKey of N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2,2-dimethylpropanamide?
The InChIKey is ACZJIEICZMXYSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c1-12(2,3)11(15)14-9-8-6-7-16-10(8)13(9,4)5/h8-10H,6-7H2,1-5H3,(H,14,15).
What are the key properties of N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2,2-dimethylpropanamide?
N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2,2-dimethylpropanamide has a molecular weight of 225.33 g/mol, XLogP of 1.96, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-2,2-dimethylpropanamide is sourced from PubChem (CID 168788092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).