C12H20O4 — CID 168792047
(3aR)-4-[2-(1-hydroxycyclopropyl)ethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol (PubChem CID 168792047) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (3aR)-4-[2-(1-hydroxycyclopropyl)ethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol.
| Compound Name | (3aR)-4-[2-(1-hydroxycyclopropyl)ethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
|---|---|
| PubChem CID | 168792047 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (3aR)-4-[2-(1-hydroxycyclopropyl)ethyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
| SMILES | OC1C[C@H]2C(CC(O)C2CCC2(O)CC2)O1 |
| InChI | InChI=1S/C12H20O4/c13-9-6-10-8(5-11(14)16-10)7(9)1-2-12(15)3-4-12/h7-11,13-15H,1-6H2/t7?,8-,9?,10?,11?/m1/s1 |
| InChIKey | KYGLZRXRSHPWJS-IYBWKAHUSA-N |
| XLogP | 0.40 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |