About methyl 5-methylsulfanyl-1,3-thiazole-2-carboxylate
methyl 5-methylsulfanyl-1,3-thiazole-2-carboxylate (PubChem CID 168792607) has the molecular formula C6H7NO2S2
and a molecular weight of 189.26 g/mol. Its IUPAC name is methyl 5-methylsulfanyl-1,3-thiazole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-methylsulfanyl-1,3-thiazole-2-carboxylate |
| PubChem CID | 168792607 |
| Molecular Formula | C6H7NO2S2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 188.99 |
| IUPAC Name | methyl 5-methylsulfanyl-1,3-thiazole-2-carboxylate |
| SMILES | COC(=O)c1ncc(SC)s1 |
| InChI | InChI=1S/C6H7NO2S2/c1-9-6(8)5-7-3-4(10-2)11-5/h3H,1-2H3 |
| InChIKey | HZMDBXNAEINWTF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-methylsulfanyl-1,3-thiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methylsulfanyl-1,3-thiazole-2-carboxylate?
The IUPAC name of methyl 5-methylsulfanyl-1,3-thiazole-2-carboxylate (CID 168792607) is methyl 5-methylsulfanyl-1,3-thiazole-2-carboxylate.
What is the SMILES notation for methyl 5-methylsulfanyl-1,3-thiazole-2-carboxylate?
The canonical SMILES for methyl 5-methylsulfanyl-1,3-thiazole-2-carboxylate is COC(=O)c1ncc(SC)s1.
What is the InChIKey of methyl 5-methylsulfanyl-1,3-thiazole-2-carboxylate?
The InChIKey is HZMDBXNAEINWTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S2/c1-9-6(8)5-7-3-4(10-2)11-5/h3H,1-2H3.
What are the key properties of methyl 5-methylsulfanyl-1,3-thiazole-2-carboxylate?
methyl 5-methylsulfanyl-1,3-thiazole-2-carboxylate has a molecular weight of 189.26 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methylsulfanyl-1,3-thiazole-2-carboxylate is sourced from PubChem (CID 168792607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).