About ethyl 2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-iminoacetate
ethyl 2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-iminoacetate (PubChem CID 168793445) has the molecular formula C10H12FN3O2
and a molecular weight of 225.22 g/mol. Its IUPAC name is ethyl 2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-iminoacetate.
Molecular Properties
| Compound Name | ethyl 2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-iminoacetate |
| PubChem CID | 168793445 |
| Molecular Formula | C10H12FN3O2 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | ethyl 2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-iminoacetate |
| SMILES | [H]/N=C(\C(=O)OCC)c1ncn2c1C[C@@H](F)C2 |
| InChI | InChI=1S/C10H12FN3O2/c1-2-16-10(15)8(12)9-7-3-6(11)4-14(7)5-13-9/h5-6,12H,2-4H2,1H3/b12-8-/t6-/m1/s1 |
| InChIKey | VDMQSDKSCAGMJB-UMZRBQTHSA-N |
| XLogP | 0.71 |
| TPSA | 67.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-iminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-iminoacetate?
The IUPAC name of ethyl 2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-iminoacetate (CID 168793445) is ethyl 2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-iminoacetate.
What is the SMILES notation for ethyl 2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-iminoacetate?
The canonical SMILES for ethyl 2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-iminoacetate is [H]/N=C(\C(=O)OCC)c1ncn2c1C[C@@H](F)C2.
What is the InChIKey of ethyl 2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-iminoacetate?
The InChIKey is VDMQSDKSCAGMJB-UMZRBQTHSA-N. The full InChI is InChI=1S/C10H12FN3O2/c1-2-16-10(15)8(12)9-7-3-6(11)4-14(7)5-13-9/h5-6,12H,2-4H2,1H3/b12-8-/t6-/m1/s1.
What are the key properties of ethyl 2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-iminoacetate?
ethyl 2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-iminoacetate has a molecular weight of 225.22 g/mol, XLogP of 0.71, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(6R)-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-yl]-2-iminoacetate is sourced from PubChem (CID 168793445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).