C22H30N6O4S — CID 168793669
6,7-dimethoxy-2-pyridin-4-yl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]-1,2-dihydroquinazoline (PubChem CID 168793669) has the molecular formula C22H30N6O4S and a molecular weight of 474.59 g/mol. Its IUPAC name is 6,7-dimethoxy-2-pyridin-4-yl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]-1,2-dihydroquinazoline.
| Compound Name | 6,7-dimethoxy-2-pyridin-4-yl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]-1,2-dihydroquinazoline |
|---|---|
| PubChem CID | 168793669 |
| Molecular Formula | C22H30N6O4S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 6,7-dimethoxy-2-pyridin-4-yl-4-[4-[2-(sulfamoylamino)ethyl]piperidin-1-yl]-1,2-dihydroquinazoline |
| SMILES | COc1cc2c(cc1OC)C(N1CCC(CCNS(N)(=O)=O)CC1)=NC(c1ccncc1)N2 |
| InChI | InChI=1S/C22H30N6O4S/c1-31-19-13-17-18(14-20(19)32-2)26-21(16-4-8-24-9-5-16)27-22(17)28-11-6-15(7-12-28)3-10-25-33(23,29)30/h4-5,8-9,13-15,21,25-26H,3,6-7,10-12H2,1-2H3,(H2,23,29,30) |
| InChIKey | ULTVNHQYFBHNJV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|