C27H48O3 — CID 168794300
(3R,5R,8R,9R,10S,13S,14S,17S)-17-(4-butoxy-1-hydroxybutyl)-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 168794300) has the molecular formula C27H48O3 and a molecular weight of 420.68 g/mol. Its IUPAC name is (3R,5R,8R,9R,10S,13S,14S,17S)-17-(4-butoxy-1-hydroxybutyl)-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5R,8R,9R,10S,13S,14S,17S)-17-(4-butoxy-1-hydroxybutyl)-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 168794300 |
| Molecular Formula | C27H48O3 |
| Molecular Weight | 420.68 g/mol |
| Exact Mass | 420.36 |
| IUPAC Name | (3R,5R,8R,9R,10S,13S,14S,17S)-17-(4-butoxy-1-hydroxybutyl)-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCCCOCCCC(O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@](C)(O)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H48O3/c1-4-5-16-30-17-6-7-25(28)24-11-10-23-22-9-8-19-18-26(2,29)14-12-20(19)21(22)13-15-27(23,24)3/h19-25,28-29H,4-18H2,1-3H3/t19-,20+,21-,22-,23+,24-,25?,26-,27+/m1/s1 |
| InChIKey | BLGSOHVXHPBZNG-XWWJEFHSSA-N |
| XLogP | 5.96 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.68 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|