C24H32N4O2S — CID 168795018
2-[6-(benzenesulfinyl)pyridazin-3-yl]-3-[(4S)-2,2-dimethyloxan-4-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 168795018) has the molecular formula C24H32N4O2S and a molecular weight of 440.61 g/mol. Its IUPAC name is 2-[6-(benzenesulfinyl)pyridazin-3-yl]-3-[(4S)-2,2-dimethyloxan-4-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | 2-[6-(benzenesulfinyl)pyridazin-3-yl]-3-[(4S)-2,2-dimethyloxan-4-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 168795018 |
| Molecular Formula | C24H32N4O2S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 2-[6-(benzenesulfinyl)pyridazin-3-yl]-3-[(4S)-2,2-dimethyloxan-4-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | CC1(C)C[C@@H](C2C3CC(N)CC3CN2c2ccc(S(=O)c3ccccc3)nn2)CCO1 |
| InChI | InChI=1S/C24H32N4O2S/c1-24(2)14-16(10-11-30-24)23-20-13-18(25)12-17(20)15-28(23)21-8-9-22(27-26-21)31(29)19-6-4-3-5-7-19/h3-9,16-18,20,23H,10-15,25H2,1-2H3/t16-,17?,18?,20?,23?,31?/m0/s1 |
| InChIKey | FWGYGFCLQNMRBC-NMYAHTTGSA-N |
| XLogP | 3.39 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |