C24H30ClFN4 — CID 168795105
N-[6-(2-chloro-5-fluorophenyl)pyridazin-3-yl]-2-cycloheptyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 168795105) has the molecular formula C24H30ClFN4 and a molecular weight of 428.98 g/mol. Its IUPAC name is N-[6-(2-chloro-5-fluorophenyl)pyridazin-3-yl]-2-cycloheptyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | N-[6-(2-chloro-5-fluorophenyl)pyridazin-3-yl]-2-cycloheptyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 168795105 |
| Molecular Formula | C24H30ClFN4 |
| Molecular Weight | 428.98 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | N-[6-(2-chloro-5-fluorophenyl)pyridazin-3-yl]-2-cycloheptyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | Fc1ccc(Cl)c(-c2ccc(NC3CC4CN(C5CCCCCC5)CC4C3)nn2)c1 |
| InChI | InChI=1S/C24H30ClFN4/c25-22-8-7-18(26)13-21(22)23-9-10-24(29-28-23)27-19-11-16-14-30(15-17(16)12-19)20-5-3-1-2-4-6-20/h7-10,13,16-17,19-20H,1-6,11-12,14-15H2,(H,27,29) |
| InChIKey | ZJFUAKVFAHGUQX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.98 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |