C17H16N2O3S — CID 16879514
N-(4-ethoxyphenyl)-2-(5-thiophen-2-yl-1,2-oxazol-3-yl)acetamide (PubChem CID 16879514) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-(5-thiophen-2-yl-1,2-oxazol-3-yl)acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-(5-thiophen-2-yl-1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 16879514 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-(5-thiophen-2-yl-1,2-oxazol-3-yl)acetamide |
| SMILES | CCOc1ccc(NC(=O)Cc2cc(-c3cccs3)on2)cc1 |
| InChI | InChI=1S/C17H16N2O3S/c1-2-21-14-7-5-12(6-8-14)18-17(20)11-13-10-15(22-19-13)16-4-3-9-23-16/h3-10H,2,11H2,1H3,(H,18,20) |
| InChIKey | XQJKWSOHUFVOPT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |