C5H11NO — CID 168795435
2,2,6,6-tetradeuteriooxan-4-amine (PubChem CID 168795435) has the molecular formula C5H11NO and a molecular weight of 105.17 g/mol. Its IUPAC name is 2,2,6,6-tetradeuteriooxan-4-amine.
| Compound Name | 2,2,6,6-tetradeuteriooxan-4-amine |
|---|---|
| PubChem CID | 168795435 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 105.17 g/mol |
| Exact Mass | 105.11 |
| IUPAC Name | 2,2,6,6-tetradeuteriooxan-4-amine |
| SMILES | [2H]C1([2H])CC(N)CC([2H])([2H])O1 |
| InChI | InChI=1S/C5H11NO/c6-5-1-3-7-4-2-5/h5H,1-4,6H2/i3D2,4D2 |
| InChIKey | AHVQYHFYQWKUKB-KHORGVISSA-N |
| XLogP | 0.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 105.17 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |