C16H17N3O3 — CID 168797397
ethyl 2-(4-ethyl-1-oxo-[1,2,4]triazino[4,5-a]indol-2-yl)acetate (PubChem CID 168797397) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is ethyl 2-(4-ethyl-1-oxo-[1,2,4]triazino[4,5-a]indol-2-yl)acetate.
| Compound Name | ethyl 2-(4-ethyl-1-oxo-[1,2,4]triazino[4,5-a]indol-2-yl)acetate |
|---|---|
| PubChem CID | 168797397 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | ethyl 2-(4-ethyl-1-oxo-[1,2,4]triazino[4,5-a]indol-2-yl)acetate |
| SMILES | CCOC(=O)Cn1nc(CC)n2c(cc3ccccc32)c1=O |
| InChI | InChI=1S/C16H17N3O3/c1-3-14-17-18(10-15(20)22-4-2)16(21)13-9-11-7-5-6-8-12(11)19(13)14/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | STDAOJQSMONOBK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |