C52H42N2 — CID 168798686
3-[7'-[3-[2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-4-pyridinyl]phenyl]spiro[adamantane-2,9'-fluorene]-1'-yl]benzonitrile (PubChem CID 168798686) has the molecular formula C52H42N2 and a molecular weight of 694.92 g/mol. Its IUPAC name is 3-[7'-[3-[2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-4-pyridinyl]phenyl]spiro[adamantane-2,9'-fluorene]-1'-yl]benzonitrile.
| Compound Name | 3-[7'-[3-[2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-4-pyridinyl]phenyl]spiro[adamantane-2,9'-fluorene]-1'-yl]benzonitrile |
|---|---|
| PubChem CID | 168798686 |
| Molecular Formula | C52H42N2 |
| Molecular Weight | 694.92 g/mol |
| Exact Mass | 694.33 |
| IUPAC Name | 3-[7'-[3-[2-[(3E)-hexa-1,3,5-trien-3-yl]-6-phenyl-4-pyridinyl]phenyl]spiro[adamantane-2,9'-fluorene]-1'-yl]benzonitrile |
| SMILES | C=C/C=C(\C=C)c1cc(-c2cccc(-c3ccc4c(c3)C3(c5c(-c6cccc(C#N)c6)cccc5-4)C4CC5CC(C4)CC3C5)c2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C52H42N2/c1-3-11-36(4-2)49-30-42(31-50(54-49)37-13-6-5-7-14-37)39-16-9-15-38(28-39)40-20-21-46-47-19-10-18-45(41-17-8-12-33(23-41)32-53)51(47)52(48(46)29-40)43-24-34-22-35(26-43)27-44(52)25-34/h3-21,23,28-31,34-35,43-44H,1-2,22,24-27H2/b36-11+ |
| InChIKey | JGGSQPFYQUXXBY-AVYBEWNYSA-N |
| XLogP | 13.10 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.92 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|