About 2-tert-butyl-3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonate
2-tert-butyl-3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonate (PubChem CID 168800235) has the molecular formula C20H25NO3S
and a molecular weight of 359.49 g/mol. Its IUPAC name is 2-tert-butyl-3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonate.
Molecular Properties
| Compound Name | 2-tert-butyl-3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonate |
| PubChem CID | 168800235 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 2-tert-butyl-3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonate |
| SMILES | CC[N+]1=C(C(C)(C)C)C(C)(C)c2c1ccc1c(S(=O)(=O)[O-])cccc21 |
| InChI | InChI=1S/C20H25NO3S/c1-7-21-15-12-11-13-14(9-8-10-16(13)25(22,23)24)17(15)20(5,6)18(21)19(2,3)4/h8-12H,7H2,1-6H3 |
| InChIKey | OHLMFOCYFOBVLR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonate?
The IUPAC name of 2-tert-butyl-3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonate (CID 168800235) is 2-tert-butyl-3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonate.
What is the SMILES notation for 2-tert-butyl-3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonate?
The canonical SMILES for 2-tert-butyl-3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonate is CC[N+]1=C(C(C)(C)C)C(C)(C)c2c1ccc1c(S(=O)(=O)[O-])cccc21.
What is the InChIKey of 2-tert-butyl-3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonate?
The InChIKey is OHLMFOCYFOBVLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO3S/c1-7-21-15-12-11-13-14(9-8-10-16(13)25(22,23)24)17(15)20(5,6)18(21)19(2,3)4/h8-12H,7H2,1-6H3.
What are the key properties of 2-tert-butyl-3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonate?
2-tert-butyl-3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonate has a molecular weight of 359.49 g/mol, XLogP of 4.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3-ethyl-1,1-dimethylbenzo[e]indol-3-ium-6-sulfonate is sourced from PubChem (CID 168800235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).