C52H32F13N3 — CID 168800374
4-[4-[bis(4-pyridin-4-ylphenyl)-[4-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]phenyl]methyl]phenyl]pyridine (PubChem CID 168800374) has the molecular formula C52H32F13N3 and a molecular weight of 945.82 g/mol. Its IUPAC name is 4-[4-[bis(4-pyridin-4-ylphenyl)-[4-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]phenyl]methyl]phenyl]pyridine.
| Compound Name | 4-[4-[bis(4-pyridin-4-ylphenyl)-[4-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]phenyl]methyl]phenyl]pyridine |
|---|---|
| PubChem CID | 168800374 |
| Molecular Formula | C52H32F13N3 |
| Molecular Weight | 945.82 g/mol |
| Exact Mass | 945.24 |
| IUPAC Name | 4-[4-[bis(4-pyridin-4-ylphenyl)-[4-[4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]phenyl]methyl]phenyl]pyridine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ccc(-c2ccc(C(c3ccc(-c4ccncc4)cc3)(c3ccc(-c4ccncc4)cc3)c3ccc(-c4ccncc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C52H32F13N3/c53-47(54,48(55,56)49(57,58)50(59,60)51(61,62)52(63,64)65)45-19-9-34(10-20-45)33-1-11-41(12-2-33)46(42-13-3-35(4-14-42)38-21-27-66-28-22-38,43-15-5-36(6-16-43)39-23-29-67-30-24-39)44-17-7-37(8-18-44)40-25-31-68-32-26-40/h1-32H |
| InChIKey | QDXPYNJHEFPRRD-UHFFFAOYSA-N |
| XLogP | 15.12 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.82 |
| LogP ≤ 5 | 15.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|