C16H17F3N2O3 — CID 168801483
(1R,2S,5S)-6,6-dimethyl-3-[2-(2,4,6-trifluoroanilino)acetyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (PubChem CID 168801483) has the molecular formula C16H17F3N2O3 and a molecular weight of 342.32 g/mol. Its IUPAC name is (1R,2S,5S)-6,6-dimethyl-3-[2-(2,4,6-trifluoroanilino)acetyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid.
| Compound Name | (1R,2S,5S)-6,6-dimethyl-3-[2-(2,4,6-trifluoroanilino)acetyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
|---|---|
| PubChem CID | 168801483 |
| Molecular Formula | C16H17F3N2O3 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (1R,2S,5S)-6,6-dimethyl-3-[2-(2,4,6-trifluoroanilino)acetyl]-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| SMILES | CC1(C)[C@@H]2[C@@H](C(=O)O)N(C(=O)CNc3c(F)cc(F)cc3F)C[C@@H]21 |
| InChI | InChI=1S/C16H17F3N2O3/c1-16(2)8-6-21(14(12(8)16)15(23)24)11(22)5-20-13-9(18)3-7(17)4-10(13)19/h3-4,8,12,14,20H,5-6H2,1-2H3,(H,23,24)/t8-,12-,14-/m0/s1 |
| InChIKey | YEAJMJUIGXOOLE-ULSRQLJBSA-N |
| XLogP | 2.08 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |