C19H23N4O2S2+ — CID 168803163
[3-amino-6-(1-methyl-6-oxopyrimidin-4-yl)-4-propan-2-ylthieno[2,3-b]pyridin-2-yl]-cyclobutyl-hydroxysulfanium (PubChem CID 168803163) has the molecular formula C19H23N4O2S2+ and a molecular weight of 403.55 g/mol. Its IUPAC name is [3-amino-6-(1-methyl-6-oxopyrimidin-4-yl)-4-propan-2-ylthieno[2,3-b]pyridin-2-yl]-cyclobutyl-hydroxysulfanium.
| Compound Name | [3-amino-6-(1-methyl-6-oxopyrimidin-4-yl)-4-propan-2-ylthieno[2,3-b]pyridin-2-yl]-cyclobutyl-hydroxysulfanium |
|---|---|
| PubChem CID | 168803163 |
| Molecular Formula | C19H23N4O2S2+ |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | [3-amino-6-(1-methyl-6-oxopyrimidin-4-yl)-4-propan-2-ylthieno[2,3-b]pyridin-2-yl]-cyclobutyl-hydroxysulfanium |
| SMILES | CC(C)c1cc(-c2cc(=O)n(C)cn2)nc2sc([S+](O)C3CCC3)c(N)c12 |
| InChI | InChI=1S/C19H23N4O2S2/c1-10(2)12-7-14(13-8-15(24)23(3)9-21-13)22-18-16(12)17(20)19(26-18)27(25)11-5-4-6-11/h7-11,25H,4-6,20H2,1-3H3/q+1 |
| InChIKey | OZHJNCXTVNQLKO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|