C30H40N6O3 — CID 168803211
[(3R)-3-methylmorpholin-4-yl]-[4-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]cyclohexyl]methanone (PubChem CID 168803211) has the molecular formula C30H40N6O3 and a molecular weight of 532.69 g/mol. Its IUPAC name is [(3R)-3-methylmorpholin-4-yl]-[4-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]cyclohexyl]methanone.
| Compound Name | [(3R)-3-methylmorpholin-4-yl]-[4-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]cyclohexyl]methanone |
|---|---|
| PubChem CID | 168803211 |
| Molecular Formula | C30H40N6O3 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | [(3R)-3-methylmorpholin-4-yl]-[4-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]cyclohexyl]methanone |
| SMILES | Cc1nc2nc(C)c(O[C@@H]3CCN(c4ccc(C5CCC(C(=O)N6CCOC[C@H]6C)CC5)cc4)C3)c(C)n2n1 |
| InChI | InChI=1S/C30H40N6O3/c1-19-18-38-16-15-35(19)29(37)25-7-5-23(6-8-25)24-9-11-26(12-10-24)34-14-13-27(17-34)39-28-20(2)31-30-32-22(4)33-36(30)21(28)3/h9-12,19,23,25,27H,5-8,13-18H2,1-4H3/t19-,23?,25?,27-/m1/s1 |
| InChIKey | HEFOWRWEZJKRFS-DEVRTDNXSA-N |
| XLogP | 4.23 |
| TPSA | 85.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|