C31H42N6O3 — CID 168803220
[(6S)-6-methyl-1,4-oxazepan-4-yl]-[4-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]cyclohexyl]methanone (PubChem CID 168803220) has the molecular formula C31H42N6O3 and a molecular weight of 546.72 g/mol. Its IUPAC name is [(6S)-6-methyl-1,4-oxazepan-4-yl]-[4-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]cyclohexyl]methanone.
| Compound Name | [(6S)-6-methyl-1,4-oxazepan-4-yl]-[4-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]cyclohexyl]methanone |
|---|---|
| PubChem CID | 168803220 |
| Molecular Formula | C31H42N6O3 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | [(6S)-6-methyl-1,4-oxazepan-4-yl]-[4-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]cyclohexyl]methanone |
| SMILES | Cc1nc2nc(C)c(O[C@@H]3CCN(c4ccc(C5CCC(C(=O)N6CCOC[C@@H](C)C6)CC5)cc4)C3)c(C)n2n1 |
| InChI | InChI=1S/C31H42N6O3/c1-20-17-36(15-16-39-19-20)30(38)26-7-5-24(6-8-26)25-9-11-27(12-10-25)35-14-13-28(18-35)40-29-21(2)32-31-33-23(4)34-37(31)22(29)3/h9-12,20,24,26,28H,5-8,13-19H2,1-4H3/t20-,24?,26?,28+/m0/s1 |
| InChIKey | WMBILCHZBZULRA-WMYRHNCCSA-N |
| XLogP | 4.48 |
| TPSA | 85.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|