C12H20N6 — CID 168803450
1-N,2-N-dimethyl-3,4,5,6-tetrakis(methylimino)cyclohexene-1,2-diamine (PubChem CID 168803450) has the molecular formula C12H20N6 and a molecular weight of 248.33 g/mol. Its IUPAC name is 1-N,2-N-dimethyl-3,4,5,6-tetrakis(methylimino)cyclohexene-1,2-diamine.
| Compound Name | 1-N,2-N-dimethyl-3,4,5,6-tetrakis(methylimino)cyclohexene-1,2-diamine |
|---|---|
| PubChem CID | 168803450 |
| Molecular Formula | C12H20N6 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 1-N,2-N-dimethyl-3,4,5,6-tetrakis(methylimino)cyclohexene-1,2-diamine |
| SMILES | C/N=c1c(NC)c(NC)c(=N/C)/c(=N/C)c/1=N\C |
| InChI | InChI=1S/C12H20N6/c1-13-7-8(14-2)10(16-4)12(18-6)11(17-5)9(7)15-3/h13-14H,1-6H3/b15-9-,16-10-,17-11-,18-12- |
| InChIKey | RKEYQVFRGFWZHQ-KGCZBHAISA-N |
| XLogP | -1.23 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|