C49H37N3O — CID 168803617
2-(7'-dibenzofuran-3-ylspiro[adamantane-2,9'-fluorene]-2'-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 168803617) has the molecular formula C49H37N3O and a molecular weight of 683.86 g/mol. Its IUPAC name is 2-(7'-dibenzofuran-3-ylspiro[adamantane-2,9'-fluorene]-2'-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(7'-dibenzofuran-3-ylspiro[adamantane-2,9'-fluorene]-2'-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 168803617 |
| Molecular Formula | C49H37N3O |
| Molecular Weight | 683.86 g/mol |
| Exact Mass | 683.29 |
| IUPAC Name | 2-(7'-dibenzofuran-3-ylspiro[adamantane-2,9'-fluorene]-2'-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)C3(c5cc(-c6ccc7c(c6)oc6ccccc67)ccc5-4)C4CC5CC(C4)CC3C5)n2)cc1 |
| InChI | InChI=1S/C49H37N3O/c1-3-9-31(10-4-1)46-50-47(32-11-5-2-6-12-32)52-48(51-46)35-17-19-39-38-18-15-33(34-16-20-41-40-13-7-8-14-44(40)53-45(41)28-34)26-42(38)49(43(39)27-35)36-22-29-21-30(24-36)25-37(49)23-29/h1-20,26-30,36-37H,21-25H2 |
| InChIKey | SAQOVNUWTOWOLL-UHFFFAOYSA-N |
| XLogP | 12.16 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.86 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |