C25H21N3 — CID 168805901
2-(9,9-dimethylfluoren-3-yl)-4-methyl-6-phenyl-1,3,5-triazine (PubChem CID 168805901) has the molecular formula C25H21N3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-(9,9-dimethylfluoren-3-yl)-4-methyl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(9,9-dimethylfluoren-3-yl)-4-methyl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 168805901 |
| Molecular Formula | C25H21N3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-(9,9-dimethylfluoren-3-yl)-4-methyl-6-phenyl-1,3,5-triazine |
| SMILES | Cc1nc(-c2ccccc2)nc(-c2ccc3c(c2)-c2ccccc2C3(C)C)n1 |
| InChI | InChI=1S/C25H21N3/c1-16-26-23(17-9-5-4-6-10-17)28-24(27-16)18-13-14-22-20(15-18)19-11-7-8-12-21(19)25(22,2)3/h4-15H,1-3H3 |
| InChIKey | WSIXSBLAOIJUCP-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |