C15H19N3O2 — CID 168806512
9,12-dimethoxy-5-methyl-4,5-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,10,12-pentaen-13-amine (PubChem CID 168806512) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 9,12-dimethoxy-5-methyl-4,5-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,10,12-pentaen-13-amine.
| Compound Name | 9,12-dimethoxy-5-methyl-4,5-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,10,12-pentaen-13-amine |
|---|---|
| PubChem CID | 168806512 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 9,12-dimethoxy-5-methyl-4,5-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),3,10,12-pentaen-13-amine |
| SMILES | COc1cc2c(cc1N)-c1cnn(C)c1CCC2OC |
| InChI | InChI=1S/C15H19N3O2/c1-18-13-4-5-14(19-2)10-7-15(20-3)12(16)6-9(10)11(13)8-17-18/h6-8,14H,4-5,16H2,1-3H3 |
| InChIKey | WEVIKKODVXURLI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|