C32H36 — CID 168808380
1-[4-(3-tert-butyl-5-phenylphenyl)phenyl]adamantane (PubChem CID 168808380) has the molecular formula C32H36 and a molecular weight of 420.64 g/mol. Its IUPAC name is 1-[4-(3-tert-butyl-5-phenylphenyl)phenyl]adamantane.
| Compound Name | 1-[4-(3-tert-butyl-5-phenylphenyl)phenyl]adamantane |
|---|---|
| PubChem CID | 168808380 |
| Molecular Formula | C32H36 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 1-[4-(3-tert-butyl-5-phenylphenyl)phenyl]adamantane |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)cc(-c2ccc(C34CC5CC(CC(C5)C3)C4)cc2)c1 |
| InChI | InChI=1S/C32H36/c1-31(2,3)30-17-27(25-7-5-4-6-8-25)16-28(18-30)26-9-11-29(12-10-26)32-19-22-13-23(20-32)15-24(14-22)21-32/h4-12,16-18,22-24H,13-15,19-21H2,1-3H3 |
| InChIKey | FMDBPZNAIMHJBN-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |