C57H30F5N5O — CID 168809503
11-[4-(2,3,4,5,6-pentafluorophenyl)dibenzofuran-2-yl]-12-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]indolo[2,3-a]carbazole (PubChem CID 168809503) has the molecular formula C57H30F5N5O and a molecular weight of 895.89 g/mol. Its IUPAC name is 11-[4-(2,3,4,5,6-pentafluorophenyl)dibenzofuran-2-yl]-12-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]indolo[2,3-a]carbazole.
| Compound Name | 11-[4-(2,3,4,5,6-pentafluorophenyl)dibenzofuran-2-yl]-12-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]indolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 168809503 |
| Molecular Formula | C57H30F5N5O |
| Molecular Weight | 895.89 g/mol |
| Exact Mass | 895.24 |
| IUPAC Name | 11-[4-(2,3,4,5,6-pentafluorophenyl)dibenzofuran-2-yl]-12-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]indolo[2,3-a]carbazole |
| SMILES | Fc1c(F)c(F)c(-c2cc(-n3c4ccccc4c4ccc5c6ccccc6n(-c6nc(-c7ccccc7)nc(-c7ccc(-c8ccccc8)cc7)n6)c5c43)cc3c2oc2ccccc23)c(F)c1F |
| InChI | InChI=1S/C57H30F5N5O/c58-47-46(48(59)50(61)51(62)49(47)60)42-30-35(29-41-38-19-9-12-22-45(38)68-54(41)42)66-43-20-10-7-17-36(43)39-27-28-40-37-18-8-11-21-44(37)67(53(40)52(39)66)57-64-55(33-15-5-2-6-16-33)63-56(65-57)34-25-23-32(24-26-34)31-13-3-1-4-14-31/h1-30H |
| InChIKey | MUCFNXUQOMLTTI-UHFFFAOYSA-N |
| XLogP | 15.33 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.89 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|