About N-[3-(2,4-dioxo-1-propan-2-ylpyrimidin-5-yl)prop-2-ynyl]-4-methylpentanamide
N-[3-(2,4-dioxo-1-propan-2-ylpyrimidin-5-yl)prop-2-ynyl]-4-methylpentanamide (PubChem CID 168810176) has the molecular formula C16H23N3O3
and a molecular weight of 305.38 g/mol. Its IUPAC name is N-[3-(2,4-dioxo-1-propan-2-ylpyrimidin-5-yl)prop-2-ynyl]-4-methylpentanamide.
Molecular Properties
| Compound Name | N-[3-(2,4-dioxo-1-propan-2-ylpyrimidin-5-yl)prop-2-ynyl]-4-methylpentanamide |
| PubChem CID | 168810176 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | N-[3-(2,4-dioxo-1-propan-2-ylpyrimidin-5-yl)prop-2-ynyl]-4-methylpentanamide |
| SMILES | CC(C)CCC(=O)NCC#Cc1cn(C(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H23N3O3/c1-11(2)7-8-14(20)17-9-5-6-13-10-19(12(3)4)16(22)18-15(13)21/h10-12H,7-9H2,1-4H3,(H,17,20)(H,18,21,22) |
| InChIKey | MIRUFYHEORWMAR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(2,4-dioxo-1-propan-2-ylpyrimidin-5-yl)prop-2-ynyl]-4-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2,4-dioxo-1-propan-2-ylpyrimidin-5-yl)prop-2-ynyl]-4-methylpentanamide?
The IUPAC name of N-[3-(2,4-dioxo-1-propan-2-ylpyrimidin-5-yl)prop-2-ynyl]-4-methylpentanamide (CID 168810176) is N-[3-(2,4-dioxo-1-propan-2-ylpyrimidin-5-yl)prop-2-ynyl]-4-methylpentanamide.
What is the SMILES notation for N-[3-(2,4-dioxo-1-propan-2-ylpyrimidin-5-yl)prop-2-ynyl]-4-methylpentanamide?
The canonical SMILES for N-[3-(2,4-dioxo-1-propan-2-ylpyrimidin-5-yl)prop-2-ynyl]-4-methylpentanamide is CC(C)CCC(=O)NCC#Cc1cn(C(C)C)c(=O)[nH]c1=O.
What is the InChIKey of N-[3-(2,4-dioxo-1-propan-2-ylpyrimidin-5-yl)prop-2-ynyl]-4-methylpentanamide?
The InChIKey is MIRUFYHEORWMAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O3/c1-11(2)7-8-14(20)17-9-5-6-13-10-19(12(3)4)16(22)18-15(13)21/h10-12H,7-9H2,1-4H3,(H,17,20)(H,18,21,22).
What are the key properties of N-[3-(2,4-dioxo-1-propan-2-ylpyrimidin-5-yl)prop-2-ynyl]-4-methylpentanamide?
N-[3-(2,4-dioxo-1-propan-2-ylpyrimidin-5-yl)prop-2-ynyl]-4-methylpentanamide has a molecular weight of 305.38 g/mol, XLogP of 1.02, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2,4-dioxo-1-propan-2-ylpyrimidin-5-yl)prop-2-ynyl]-4-methylpentanamide is sourced from PubChem (CID 168810176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).