About N-(benzenesulfonyl)-N-(2,2,2-trifluoroethyl)acetamide
N-(benzenesulfonyl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 168810785) has the molecular formula C10H10F3NO3S
and a molecular weight of 281.25 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N-(2,2,2-trifluoroethyl)acetamide.
Molecular Properties
| Compound Name | N-(benzenesulfonyl)-N-(2,2,2-trifluoroethyl)acetamide |
| PubChem CID | 168810785 |
| Molecular Formula | C10H10F3NO3S |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | N-(benzenesulfonyl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CC(=O)N(CC(F)(F)F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H10F3NO3S/c1-8(15)14(7-10(11,12)13)18(16,17)9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
| InChIKey | ZVWOZKNQILWXTB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(benzenesulfonyl)-N-(2,2,2-trifluoroethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(benzenesulfonyl)-N-(2,2,2-trifluoroethyl)acetamide?
The IUPAC name of N-(benzenesulfonyl)-N-(2,2,2-trifluoroethyl)acetamide (CID 168810785) is N-(benzenesulfonyl)-N-(2,2,2-trifluoroethyl)acetamide.
What is the SMILES notation for N-(benzenesulfonyl)-N-(2,2,2-trifluoroethyl)acetamide?
The canonical SMILES for N-(benzenesulfonyl)-N-(2,2,2-trifluoroethyl)acetamide is CC(=O)N(CC(F)(F)F)S(=O)(=O)c1ccccc1.
What is the InChIKey of N-(benzenesulfonyl)-N-(2,2,2-trifluoroethyl)acetamide?
The InChIKey is ZVWOZKNQILWXTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NO3S/c1-8(15)14(7-10(11,12)13)18(16,17)9-5-3-2-4-6-9/h2-6H,7H2,1H3.
What are the key properties of N-(benzenesulfonyl)-N-(2,2,2-trifluoroethyl)acetamide?
N-(benzenesulfonyl)-N-(2,2,2-trifluoroethyl)acetamide has a molecular weight of 281.25 g/mol, XLogP of 1.79, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(benzenesulfonyl)-N-(2,2,2-trifluoroethyl)acetamide is sourced from PubChem (CID 168810785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).