About 9-tert-butyl-1-phenyl-4a,9b-dihydrodibenzothiophene
9-tert-butyl-1-phenyl-4a,9b-dihydrodibenzothiophene (PubChem CID 168811507) has the molecular formula C22H22S
and a molecular weight of 318.49 g/mol. Its IUPAC name is 9-tert-butyl-1-phenyl-4a,9b-dihydrodibenzothiophene.
Molecular Properties
| Compound Name | 9-tert-butyl-1-phenyl-4a,9b-dihydrodibenzothiophene |
| PubChem CID | 168811507 |
| Molecular Formula | C22H22S |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 9-tert-butyl-1-phenyl-4a,9b-dihydrodibenzothiophene |
| SMILES | CC(C)(C)c1cccc2c1C1C(c3ccccc3)=CC=CC1S2 |
| InChI | InChI=1S/C22H22S/c1-22(2,3)17-12-8-14-19-21(17)20-16(11-7-13-18(20)23-19)15-9-5-4-6-10-15/h4-14,18,20H,1-3H3 |
| InChIKey | YEOUEKOMGRPFMM-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-tert-butyl-1-phenyl-4a,9b-dihydrodibenzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-tert-butyl-1-phenyl-4a,9b-dihydrodibenzothiophene?
The IUPAC name of 9-tert-butyl-1-phenyl-4a,9b-dihydrodibenzothiophene (CID 168811507) is 9-tert-butyl-1-phenyl-4a,9b-dihydrodibenzothiophene.
What is the SMILES notation for 9-tert-butyl-1-phenyl-4a,9b-dihydrodibenzothiophene?
The canonical SMILES for 9-tert-butyl-1-phenyl-4a,9b-dihydrodibenzothiophene is CC(C)(C)c1cccc2c1C1C(c3ccccc3)=CC=CC1S2.
What is the InChIKey of 9-tert-butyl-1-phenyl-4a,9b-dihydrodibenzothiophene?
The InChIKey is YEOUEKOMGRPFMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22S/c1-22(2,3)17-12-8-14-19-21(17)20-16(11-7-13-18(20)23-19)15-9-5-4-6-10-15/h4-14,18,20H,1-3H3.
What are the key properties of 9-tert-butyl-1-phenyl-4a,9b-dihydrodibenzothiophene?
9-tert-butyl-1-phenyl-4a,9b-dihydrodibenzothiophene has a molecular weight of 318.49 g/mol, XLogP of 6.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-tert-butyl-1-phenyl-4a,9b-dihydrodibenzothiophene is sourced from PubChem (CID 168811507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).