C100H79N5OPt-2 — CID 168811549
CID 168811549 (PubChem CID 168811549) has the molecular formula C100H79N5OPt-2 and a molecular weight of 1561.84 g/mol.
| Compound Name | CID 168811549 |
|---|---|
| PubChem CID | 168811549 |
| Molecular Formula | C100H79N5OPt-2 |
| Molecular Weight | 1561.84 g/mol |
| Exact Mass | 1560.59 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5[c-][n+](-c6c(-c7ccc8c(c7)C(C)(C)c7ccccc7C8(C)C)cccc6-c6ccc7c(c6)C(C)(C)c6ccccc6C7(C)C)c6ccccc65)ccc4)ccc3c3cc4c(cc32)c2ccccc2c2ccccc2c2cccc3c5ccccc5n4c23)c1.[Pt] |
| InChI | InChI=1S/C100H79N5O.Pt/c1-96(2,3)63-51-52-101-93(55-63)104-90-57-66(47-48-74(90)78-59-92-77(58-91(78)104)72-32-15-13-30-70(72)69-29-12-14-31-71(69)75-36-26-37-76-73-33-16-21-42-87(73)105(92)95(75)76)106-65-28-24-27-64(56-65)102-60-103(89-44-23-22-43-88(89)102)94-67(61-45-49-83-85(53-61)99(8,9)81-40-19-17-38-79(81)97(83,4)5)34-25-35-68(94)62-46-50-84-86(54-62)100(10,11)82-41-20-18-39-80(82)98(84,6)7;/h12-55,58-59H,1-11H3;/q-2; |
| InChIKey | LGKUSULDJQIASY-UHFFFAOYSA-N |
| XLogP | 24.73 |
| TPSA | 40.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 107 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1561.84 |
| LogP ≤ 5 | 24.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|