C13H11F6IrO2- — CID 168812323
1,3-dimethylbenzene-6-ide;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium (PubChem CID 168812323) has the molecular formula C13H11F6IrO2- and a molecular weight of 505.43 g/mol. Its IUPAC name is 1,3-dimethylbenzene-6-ide;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 1,3-dimethylbenzene-6-ide;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 168812323 |
| Molecular Formula | C13H11F6IrO2- |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | 1,3-dimethylbenzene-6-ide;(Z)-1,1,1,5,5,5-hexafluoro-4-hydroxypent-3-en-2-one;iridium |
| SMILES | Cc1[c-]ccc(C)c1.O=C(/C=C(\O)C(F)(F)F)C(F)(F)F.[Ir] |
| InChI | InChI=1S/C8H9.C5H2F6O2.Ir/c1-7-4-3-5-8(2)6-7;6-4(7,8)2(12)1-3(13)5(9,10)11;/h3-4,6H,1-2H3;1,12H;/q-1;;/b;2-1-; |
| InChIKey | VNQCYBDVAIVZGY-FJOGWHKWSA-N |
| XLogP | 4.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|