C37H29NO2 — CID 168812346
6-deuterio-2-(8,8,14,14-tetramethyl-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-5-yl)xanthen-9-one (PubChem CID 168812346) has the molecular formula C37H29NO2 and a molecular weight of 520.65 g/mol. Its IUPAC name is 6-deuterio-2-(8,8,14,14-tetramethyl-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-5-yl)xanthen-9-one.
| Compound Name | 6-deuterio-2-(8,8,14,14-tetramethyl-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-5-yl)xanthen-9-one |
|---|---|
| PubChem CID | 168812346 |
| Molecular Formula | C37H29NO2 |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 6-deuterio-2-(8,8,14,14-tetramethyl-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-5-yl)xanthen-9-one |
| SMILES | [2H]c1ccc2c(=O)c3cc(-c4ccc5c(c4)C(C)(C)c4cccc6c4N5c4ccccc4C6(C)C)ccc3oc2c1 |
| InChI | InChI=1S/C37H29NO2/c1-36(2)26-11-6-7-14-30(26)38-31-18-16-23(21-29(31)37(3,4)28-13-9-12-27(36)34(28)38)22-17-19-33-25(20-22)35(39)24-10-5-8-15-32(24)40-33/h5-21H,1-4H3/i8D |
| InChIKey | LLTFTKDKQPGIQY-BNEYPBHNSA-N |
| XLogP | 9.36 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|