C60H40N4 — CID 168814011
N,9-diphenyl-N-[4-[4-(N-(9-phenyl-7,8-dihydrocarbazol-3-yl)anilino)cyclohexa-1,2,3,5-tetraen-1-yl]cyclohexa-1,2,3,5-tetraen-1-yl]carbazol-3-amine (PubChem CID 168814011) has the molecular formula C60H40N4 and a molecular weight of 817.01 g/mol. Its IUPAC name is N,9-diphenyl-N-[4-[4-(N-(9-phenyl-7,8-dihydrocarbazol-3-yl)anilino)cyclohexa-1,2,3,5-tetraen-1-yl]cyclohexa-1,2,3,5-tetraen-1-yl]carbazol-3-amine.
| Compound Name | N,9-diphenyl-N-[4-[4-(N-(9-phenyl-7,8-dihydrocarbazol-3-yl)anilino)cyclohexa-1,2,3,5-tetraen-1-yl]cyclohexa-1,2,3,5-tetraen-1-yl]carbazol-3-amine |
|---|---|
| PubChem CID | 168814011 |
| Molecular Formula | C60H40N4 |
| Molecular Weight | 817.01 g/mol |
| Exact Mass | 816.33 |
| IUPAC Name | N,9-diphenyl-N-[4-[4-(N-(9-phenyl-7,8-dihydrocarbazol-3-yl)anilino)cyclohexa-1,2,3,5-tetraen-1-yl]cyclohexa-1,2,3,5-tetraen-1-yl]carbazol-3-amine |
| SMILES | C1=C=C(N(c2ccccc2)c2ccc3c(c2)c2c(n3-c3ccccc3)CCC=C2)C=CC=1C1=C=C=C(N(c2ccccc2)c2ccc3c(c2)c2ccccc2n3-c2ccccc2)C=C1 |
| InChI | InChI=1S/C60H40N4/c1-5-17-45(18-6-1)61(51-37-39-59-55(41-51)53-25-13-15-27-57(53)63(59)47-21-9-3-10-22-47)49-33-29-43(30-34-49)44-31-35-50(36-32-44)62(46-19-7-2-8-20-46)52-38-40-60-56(42-52)54-26-14-16-28-58(54)64(60)48-23-11-4-12-24-48/h1-15,17-27,29,31,33,35,37-42H,16,28H2 |
| InChIKey | JANSPKOHNSRZNS-UHFFFAOYSA-N |
| XLogP | 14.93 |
| TPSA | 16.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.01 |
| LogP ≤ 5 | 14.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |