C52H46N2OS — CID 168814507
N-[4-[9-(4-tert-butylphenyl)-4a,5,6,9a-tetrahydrocarbazol-2-yl]cyclohexa-1,5-dien-1-yl]-N-dibenzothiophen-3-yl-2,3-dihydrodibenzofuran-4-amine (PubChem CID 168814507) has the molecular formula C52H46N2OS and a molecular weight of 747.02 g/mol. Its IUPAC name is N-[4-[9-(4-tert-butylphenyl)-4a,5,6,9a-tetrahydrocarbazol-2-yl]cyclohexa-1,5-dien-1-yl]-N-dibenzothiophen-3-yl-2,3-dihydrodibenzofuran-4-amine.
| Compound Name | N-[4-[9-(4-tert-butylphenyl)-4a,5,6,9a-tetrahydrocarbazol-2-yl]cyclohexa-1,5-dien-1-yl]-N-dibenzothiophen-3-yl-2,3-dihydrodibenzofuran-4-amine |
|---|---|
| PubChem CID | 168814507 |
| Molecular Formula | C52H46N2OS |
| Molecular Weight | 747.02 g/mol |
| Exact Mass | 746.33 |
| IUPAC Name | N-[4-[9-(4-tert-butylphenyl)-4a,5,6,9a-tetrahydrocarbazol-2-yl]cyclohexa-1,5-dien-1-yl]-N-dibenzothiophen-3-yl-2,3-dihydrodibenzofuran-4-amine |
| SMILES | CC(C)(C)c1ccc(N2C3=C(CCC=C3)C3C=CC(C4C=CC(N(C5=c6oc7ccccc7c6=CCC5)c5ccc6c(c5)sc5ccccc56)=CC4)=CC32)cc1 |
| InChI | InChI=1S/C52H46N2OS/c1-52(2,3)35-22-26-37(27-23-35)54-45-15-7-4-11-39(45)40-29-21-34(31-47(40)54)33-19-24-36(25-20-33)53(38-28-30-43-42-13-6-9-18-49(42)56-50(43)32-38)46-16-10-14-44-41-12-5-8-17-48(41)55-51(44)46/h5-9,12-15,17-19,21-33,40,47H,4,10-11,16,20H2,1-3H3 |
| InChIKey | BRZZAUBUSZXHAC-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.02 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |