C28H40O17 — CID 168814944
methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-propan-2-yloxan-2-yl]methoxy]oxane-2-carboxylate (PubChem CID 168814944) has the molecular formula C28H40O17 and a molecular weight of 648.61 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-propan-2-yloxan-2-yl]methoxy]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-propan-2-yloxan-2-yl]methoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 168814944 |
| Molecular Formula | C28H40O17 |
| Molecular Weight | 648.61 g/mol |
| Exact Mass | 648.23 |
| IUPAC Name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(2R,3S,4R,5S,6S)-3,4,5-triacetyloxy-6-propan-2-yloxan-2-yl]methoxy]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](OC[C@H]2O[C@@H](C(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H40O17/c1-11(2)19-21(39-13(4)30)22(40-14(5)31)20(38-12(3)29)18(44-19)10-37-28-26(43-17(8)34)24(42-16(7)33)23(41-15(6)32)25(45-28)27(35)36-9/h11,18-26,28H,10H2,1-9H3/t18-,19+,20+,21+,22+,23+,24+,25+,26-,28-/m1/s1 |
| InChIKey | LAITTXILEZTHSX-WMYVQTKESA-N |
| XLogP | -0.09 |
| TPSA | 211.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.61 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|