C27H29F4N5O2Si — CID 168817639
(3R,4R)-4-[4-[1-(difluoromethyl)pyrazol-4-yl]-2,6-difluorophenyl]-3-methyl-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]azetidin-2-one (PubChem CID 168817639) has the molecular formula C27H29F4N5O2Si and a molecular weight of 559.64 g/mol. Its IUPAC name is (3R,4R)-4-[4-[1-(difluoromethyl)pyrazol-4-yl]-2,6-difluorophenyl]-3-methyl-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]azetidin-2-one.
| Compound Name | (3R,4R)-4-[4-[1-(difluoromethyl)pyrazol-4-yl]-2,6-difluorophenyl]-3-methyl-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]azetidin-2-one |
|---|---|
| PubChem CID | 168817639 |
| Molecular Formula | C27H29F4N5O2Si |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | (3R,4R)-4-[4-[1-(difluoromethyl)pyrazol-4-yl]-2,6-difluorophenyl]-3-methyl-1-[1-(2-trimethylsilylethoxymethyl)benzimidazol-5-yl]azetidin-2-one |
| SMILES | C[C@H]1C(=O)N(c2ccc3c(c2)ncn3COCC[Si](C)(C)C)[C@H]1c1c(F)cc(-c2cnn(C(F)F)c2)cc1F |
| InChI | InChI=1S/C27H29F4N5O2Si/c1-16-25(24-20(28)9-17(10-21(24)29)18-12-33-35(13-18)27(30)31)36(26(16)37)19-5-6-23-22(11-19)32-14-34(23)15-38-7-8-39(2,3)4/h5-6,9-14,16,25,27H,7-8,15H2,1-4H3/t16-,25-/m1/s1 |
| InChIKey | KZHIFNWWBUMYDF-PUAOIOHZSA-N |
| XLogP | 6.61 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|