C51H33N5 — CID 168818398
2,9-diphenyl-4-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,10-phenanthroline (PubChem CID 168818398) has the molecular formula C51H33N5 and a molecular weight of 715.86 g/mol. Its IUPAC name is 2,9-diphenyl-4-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,10-phenanthroline.
| Compound Name | 2,9-diphenyl-4-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 168818398 |
| Molecular Formula | C51H33N5 |
| Molecular Weight | 715.86 g/mol |
| Exact Mass | 715.27 |
| IUPAC Name | 2,9-diphenyl-4-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-1,10-phenanthroline |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5cc(-c6ccccc6)nc6c5ccc5ccc(-c7ccccc7)nc56)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C51H33N5/c1-5-13-34(14-6-1)35-21-25-41(26-22-35)50-54-49(40-19-11-4-12-20-40)55-51(56-50)42-27-23-36(24-28-42)44-33-46(38-17-9-3-10-18-38)53-48-43(44)31-29-39-30-32-45(52-47(39)48)37-15-7-2-8-16-37/h1-33H |
| InChIKey | GGWSLEOTSBLHIZ-UHFFFAOYSA-N |
| XLogP | 12.64 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.86 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|