C19H30F2N6O — CID 168818586
5-[3-[[2-(difluoromethyl)cyclohexyl]methyl]-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridin-5-yl]-3-oxodiazinane-4-carbonitrile (PubChem CID 168818586) has the molecular formula C19H30F2N6O and a molecular weight of 396.49 g/mol. Its IUPAC name is 5-[3-[[2-(difluoromethyl)cyclohexyl]methyl]-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridin-5-yl]-3-oxodiazinane-4-carbonitrile.
| Compound Name | 5-[3-[[2-(difluoromethyl)cyclohexyl]methyl]-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridin-5-yl]-3-oxodiazinane-4-carbonitrile |
|---|---|
| PubChem CID | 168818586 |
| Molecular Formula | C19H30F2N6O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 5-[3-[[2-(difluoromethyl)cyclohexyl]methyl]-2,3a,4,6,7,7a-hexahydro-1H-imidazo[4,5-c]pyridin-5-yl]-3-oxodiazinane-4-carbonitrile |
| SMILES | N#CC1C(=O)NNCC1N1CCC2NCN(CC3CCCCC3C(F)F)C2C1 |
| InChI | InChI=1S/C19H30F2N6O/c20-18(21)13-4-2-1-3-12(13)9-27-11-23-15-5-6-26(10-17(15)27)16-8-24-25-19(28)14(16)7-22/h12-18,23-24H,1-6,8-11H2,(H,25,28) |
| InChIKey | QLZGYOZWGDRBBY-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 83.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |