C19H20F3N5O2 — CID 16881898
3-(1-tert-butyl-6-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 16881898) has the molecular formula C19H20F3N5O2 and a molecular weight of 407.40 g/mol. Its IUPAC name is 3-(1-tert-butyl-6-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 3-(1-tert-butyl-6-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 16881898 |
| Molecular Formula | C19H20F3N5O2 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 3-(1-tert-butyl-6-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | Cc1nc2c(cnn2C(C)(C)C)c(=O)n1CCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H20F3N5O2/c1-10-24-17-11(9-23-27(17)19(2,3)4)18(29)26(10)8-7-14(28)25-13-6-5-12(20)15(21)16(13)22/h5-6,9H,7-8H2,1-4H3,(H,25,28) |
| InChIKey | VJKZKQNSAQUKSK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|